C13H26N2O2S — CID 82752119
2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-(2-methylsulfonylethyl)ethanamine (PubChem CID 82752119) has the molecular formula C13H26N2O2S and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-(2-methylsulfonylethyl)ethanamine.
| Compound Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-(2-methylsulfonylethyl)ethanamine |
|---|---|
| PubChem CID | 82752119 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-(2,3,3a,4,5,6,7,7a-octahydroindol-1-yl)-N-(2-methylsulfonylethyl)ethanamine |
| SMILES | CS(=O)(=O)CCNCCN1CCC2CCCCC21 |
| InChI | InChI=1S/C13H26N2O2S/c1-18(16,17)11-8-14-7-10-15-9-6-12-4-2-3-5-13(12)15/h12-14H,2-11H2,1H3 |
| InChIKey | VKMSOOQQTUKHMS-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|