C14H16BrNO — CID 82756821
N-(2-bromo-5-methylphenyl)bicyclo[3.1.0]hexane-3-carboxamide (PubChem CID 82756821) has the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. Its IUPAC name is N-(2-bromo-5-methylphenyl)bicyclo[3.1.0]hexane-3-carboxamide.
| Compound Name | N-(2-bromo-5-methylphenyl)bicyclo[3.1.0]hexane-3-carboxamide |
|---|---|
| PubChem CID | 82756821 |
| Molecular Formula | C14H16BrNO |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | N-(2-bromo-5-methylphenyl)bicyclo[3.1.0]hexane-3-carboxamide |
| SMILES | Cc1ccc(Br)c(NC(=O)C2CC3CC3C2)c1 |
| InChI | InChI=1S/C14H16BrNO/c1-8-2-3-12(15)13(4-8)16-14(17)11-6-9-5-10(9)7-11/h2-4,9-11H,5-7H2,1H3,(H,16,17) |
| InChIKey | JRAMREBNJYCITQ-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |