About 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine
2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine (PubChem CID 82762846) has the molecular formula C14H20N4O
and a molecular weight of 260.34 g/mol. Its IUPAC name is 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine.
Molecular Properties
| Compound Name | 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine |
| PubChem CID | 82762846 |
| Molecular Formula | C14H20N4O |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine |
| SMILES | CCOc1ccc2[nH]c(C3(C)CCCC3N)nc2n1 |
| InChI | InChI=1S/C14H20N4O/c1-3-19-11-7-6-9-12(17-11)18-13(16-9)14(2)8-4-5-10(14)15/h6-7,10H,3-5,8,15H2,1-2H3,(H,16,17,18) |
| InChIKey | ZLFZVQUWVSZEAF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine?
The IUPAC name of 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine (CID 82762846) is 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine.
What is the SMILES notation for 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine?
The canonical SMILES for 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine is CCOc1ccc2[nH]c(C3(C)CCCC3N)nc2n1.
What is the InChIKey of 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine?
The InChIKey is ZLFZVQUWVSZEAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N4O/c1-3-19-11-7-6-9-12(17-11)18-13(16-9)14(2)8-4-5-10(14)15/h6-7,10H,3-5,8,15H2,1-2H3,(H,16,17,18).
What are the key properties of 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine?
2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine has a molecular weight of 260.34 g/mol, XLogP of 2.13, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-ethoxy-1H-imidazo[4,5-b]pyridin-2-yl)-2-methylcyclopentan-1-amine is sourced from PubChem (CID 82762846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).