C12H12ClF2N3S — CID 82774572
N-[[5-(4-chloro-2,5-difluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine (PubChem CID 82774572) has the molecular formula C12H12ClF2N3S and a molecular weight of 303.77 g/mol. Its IUPAC name is N-[[5-(4-chloro-2,5-difluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine.
| Compound Name | N-[[5-(4-chloro-2,5-difluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 82774572 |
| Molecular Formula | C12H12ClF2N3S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | N-[[5-(4-chloro-2,5-difluorophenyl)-1,3,4-thiadiazol-2-yl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1nnc(-c2cc(F)c(Cl)cc2F)s1 |
| InChI | InChI=1S/C12H12ClF2N3S/c1-6(2)16-5-11-17-18-12(19-11)7-3-10(15)8(13)4-9(7)14/h3-4,6,16H,5H2,1-2H3 |
| InChIKey | SCXVFRXZKUEGQR-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|