C17H25BrClNO — CID 82776674
1-(4-bromo-2-chlorophenyl)-3-(4-ethylazepan-1-yl)propan-1-ol (PubChem CID 82776674) has the molecular formula C17H25BrClNO and a molecular weight of 374.75 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-(4-ethylazepan-1-yl)propan-1-ol.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-(4-ethylazepan-1-yl)propan-1-ol |
|---|---|
| PubChem CID | 82776674 |
| Molecular Formula | C17H25BrClNO |
| Molecular Weight | 374.75 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-(4-ethylazepan-1-yl)propan-1-ol |
| SMILES | CCC1CCCN(CCC(O)c2ccc(Br)cc2Cl)CC1 |
| InChI | InChI=1S/C17H25BrClNO/c1-2-13-4-3-9-20(10-7-13)11-8-17(21)15-6-5-14(18)12-16(15)19/h5-6,12-13,17,21H,2-4,7-11H2,1H3 |
| InChIKey | CPZWSGHGUIADED-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.75 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |