C14H19BrClNO3 — CID 82781196
1-(4-bromo-2-chlorophenyl)-3-[2-(hydroxymethyl)morpholin-4-yl]propan-1-ol (PubChem CID 82781196) has the molecular formula C14H19BrClNO3 and a molecular weight of 364.67 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-[2-(hydroxymethyl)morpholin-4-yl]propan-1-ol.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-[2-(hydroxymethyl)morpholin-4-yl]propan-1-ol |
|---|---|
| PubChem CID | 82781196 |
| Molecular Formula | C14H19BrClNO3 |
| Molecular Weight | 364.67 g/mol |
| Exact Mass | 363.02 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-[2-(hydroxymethyl)morpholin-4-yl]propan-1-ol |
| SMILES | OCC1CN(CCC(O)c2ccc(Br)cc2Cl)CCO1 |
| InChI | InChI=1S/C14H19BrClNO3/c15-10-1-2-12(13(16)7-10)14(19)3-4-17-5-6-20-11(8-17)9-18/h1-2,7,11,14,18-19H,3-6,8-9H2 |
| InChIKey | ZCZXHZUYPFNGKM-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.67 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |