C13H17BrClNOS — CID 82781081
1-(4-bromo-2-chlorophenyl)-3-thiomorpholin-4-ylpropan-1-ol (PubChem CID 82781081) has the molecular formula C13H17BrClNOS and a molecular weight of 350.71 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-3-thiomorpholin-4-ylpropan-1-ol.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-3-thiomorpholin-4-ylpropan-1-ol |
|---|---|
| PubChem CID | 82781081 |
| Molecular Formula | C13H17BrClNOS |
| Molecular Weight | 350.71 g/mol |
| Exact Mass | 348.99 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-3-thiomorpholin-4-ylpropan-1-ol |
| SMILES | OC(CCN1CCSCC1)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H17BrClNOS/c14-10-1-2-11(12(15)9-10)13(17)3-4-16-5-7-18-8-6-16/h1-2,9,13,17H,3-8H2 |
| InChIKey | PKWVHCYBEOQARE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.71 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |