C15H22BrClN2S — CID 82779873
1-(4-bromo-2-chlorophenyl)-N-ethyl-3-thiomorpholin-4-ylpropan-1-amine (PubChem CID 82779873) has the molecular formula C15H22BrClN2S and a molecular weight of 377.78 g/mol. Its IUPAC name is 1-(4-bromo-2-chlorophenyl)-N-ethyl-3-thiomorpholin-4-ylpropan-1-amine.
| Compound Name | 1-(4-bromo-2-chlorophenyl)-N-ethyl-3-thiomorpholin-4-ylpropan-1-amine |
|---|---|
| PubChem CID | 82779873 |
| Molecular Formula | C15H22BrClN2S |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 1-(4-bromo-2-chlorophenyl)-N-ethyl-3-thiomorpholin-4-ylpropan-1-amine |
| SMILES | CCNC(CCN1CCSCC1)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H22BrClN2S/c1-2-18-15(5-6-19-7-9-20-10-8-19)13-4-3-12(16)11-14(13)17/h3-4,11,15,18H,2,5-10H2,1H3 |
| InChIKey | LFSKPOSFYQEKFH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |