C15H20BrClO2 — CID 82779450
2-(4-bromo-2-chlorophenyl)-5-(oxolan-2-yl)pentan-2-ol (PubChem CID 82779450) has the molecular formula C15H20BrClO2 and a molecular weight of 347.68 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenyl)-5-(oxolan-2-yl)pentan-2-ol.
| Compound Name | 2-(4-bromo-2-chlorophenyl)-5-(oxolan-2-yl)pentan-2-ol |
|---|---|
| PubChem CID | 82779450 |
| Molecular Formula | C15H20BrClO2 |
| Molecular Weight | 347.68 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | 2-(4-bromo-2-chlorophenyl)-5-(oxolan-2-yl)pentan-2-ol |
| SMILES | CC(O)(CCCC1CCCO1)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C15H20BrClO2/c1-15(18,8-2-4-12-5-3-9-19-12)13-7-6-11(16)10-14(13)17/h6-7,10,12,18H,2-5,8-9H2,1H3 |
| InChIKey | UMMXGLOIGSAWBZ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.68 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |