C14H18BrClO2 — CID 82779706
2-(4-bromo-2-chlorophenyl)-4-(oxolan-2-yl)butan-2-ol (PubChem CID 82779706) has the molecular formula C14H18BrClO2 and a molecular weight of 333.65 g/mol. Its IUPAC name is 2-(4-bromo-2-chlorophenyl)-4-(oxolan-2-yl)butan-2-ol.
| Compound Name | 2-(4-bromo-2-chlorophenyl)-4-(oxolan-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 82779706 |
| Molecular Formula | C14H18BrClO2 |
| Molecular Weight | 333.65 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-(4-bromo-2-chlorophenyl)-4-(oxolan-2-yl)butan-2-ol |
| SMILES | CC(O)(CCC1CCCO1)c1ccc(Br)cc1Cl |
| InChI | InChI=1S/C14H18BrClO2/c1-14(17,7-6-11-3-2-8-18-11)12-5-4-10(15)9-13(12)16/h4-5,9,11,17H,2-3,6-8H2,1H3 |
| InChIKey | UHZQMQBTHXTJKW-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.65 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |