C12H14F3NOS — CID 82787654
3-[5-(4,4,4-trifluorobutoxymethyl)thiophen-2-yl]prop-2-yn-1-amine (PubChem CID 82787654) has the molecular formula C12H14F3NOS and a molecular weight of 277.31 g/mol. Its IUPAC name is 3-[5-(4,4,4-trifluorobutoxymethyl)thiophen-2-yl]prop-2-yn-1-amine.
| Compound Name | 3-[5-(4,4,4-trifluorobutoxymethyl)thiophen-2-yl]prop-2-yn-1-amine |
|---|---|
| PubChem CID | 82787654 |
| Molecular Formula | C12H14F3NOS |
| Molecular Weight | 277.31 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 3-[5-(4,4,4-trifluorobutoxymethyl)thiophen-2-yl]prop-2-yn-1-amine |
| SMILES | NCC#Cc1ccc(COCCCC(F)(F)F)s1 |
| InChI | InChI=1S/C12H14F3NOS/c13-12(14,15)6-2-8-17-9-11-5-4-10(18-11)3-1-7-16/h4-5H,2,6-9,16H2 |
| InChIKey | BDWIIFLHONQVDM-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|