C10H15F3N2O — CID 82789681
2-amino-2-cyclopropyl-3-(4,4,4-trifluorobutoxy)propanenitrile (PubChem CID 82789681) has the molecular formula C10H15F3N2O and a molecular weight of 236.24 g/mol. Its IUPAC name is 2-amino-2-cyclopropyl-3-(4,4,4-trifluorobutoxy)propanenitrile.
| Compound Name | 2-amino-2-cyclopropyl-3-(4,4,4-trifluorobutoxy)propanenitrile |
|---|---|
| PubChem CID | 82789681 |
| Molecular Formula | C10H15F3N2O |
| Molecular Weight | 236.24 g/mol |
| Exact Mass | 236.11 |
| IUPAC Name | 2-amino-2-cyclopropyl-3-(4,4,4-trifluorobutoxy)propanenitrile |
| SMILES | N#CC(N)(COCCCC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C10H15F3N2O/c11-10(12,13)4-1-5-16-7-9(15,6-14)8-2-3-8/h8H,1-5,7,15H2 |
| InChIKey | JBOJQDACNXPSLU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|