About N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine
N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine (PubChem CID 82789904) has the molecular formula C12H22F3NO2
and a molecular weight of 269.31 g/mol. Its IUPAC name is N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine.
Molecular Properties
| Compound Name | N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine |
| PubChem CID | 82789904 |
| Molecular Formula | C12H22F3NO2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine |
| SMILES | CCCNC1CCOCC1OCCCC(F)(F)F |
| InChI | InChI=1S/C12H22F3NO2/c1-2-6-16-10-4-8-17-9-11(10)18-7-3-5-12(13,14)15/h10-11,16H,2-9H2,1H3 |
| InChIKey | XFHHCVUQMMCDJZ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine?
The IUPAC name of N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine (CID 82789904) is N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine.
What is the SMILES notation for N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine?
The canonical SMILES for N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine is CCCNC1CCOCC1OCCCC(F)(F)F.
What is the InChIKey of N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine?
The InChIKey is XFHHCVUQMMCDJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3NO2/c1-2-6-16-10-4-8-17-9-11(10)18-7-3-5-12(13,14)15/h10-11,16H,2-9H2,1H3.
What are the key properties of N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine?
N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine has a molecular weight of 269.31 g/mol, XLogP of 2.50, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-propyl-3-(4,4,4-trifluorobutoxy)oxan-4-amine is sourced from PubChem (CID 82789904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).