C16H19Cl2NO2 — CID 82810932
4-(2-azaspiro[3.6]decan-2-yl)-3,5-dichlorobenzoic acid (PubChem CID 82810932) has the molecular formula C16H19Cl2NO2 and a molecular weight of 328.24 g/mol. Its IUPAC name is 4-(2-azaspiro[3.6]decan-2-yl)-3,5-dichlorobenzoic acid.
| Compound Name | 4-(2-azaspiro[3.6]decan-2-yl)-3,5-dichlorobenzoic acid |
|---|---|
| PubChem CID | 82810932 |
| Molecular Formula | C16H19Cl2NO2 |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 4-(2-azaspiro[3.6]decan-2-yl)-3,5-dichlorobenzoic acid |
| SMILES | O=C(O)c1cc(Cl)c(N2CC3(CCCCCC3)C2)c(Cl)c1 |
| InChI | InChI=1S/C16H19Cl2NO2/c17-12-7-11(15(20)21)8-13(18)14(12)19-9-16(10-19)5-3-1-2-4-6-16/h7-8H,1-6,9-10H2,(H,20,21) |
| InChIKey | OPBVZNMBXJGEAC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |