C11H10ClF2N3 — CID 82820462
4-(1-chloroethyl)-1-(2,6-difluoro-3-methylphenyl)triazole (PubChem CID 82820462) has the molecular formula C11H10ClF2N3 and a molecular weight of 257.67 g/mol. Its IUPAC name is 4-(1-chloroethyl)-1-(2,6-difluoro-3-methylphenyl)triazole.
| Compound Name | 4-(1-chloroethyl)-1-(2,6-difluoro-3-methylphenyl)triazole |
|---|---|
| PubChem CID | 82820462 |
| Molecular Formula | C11H10ClF2N3 |
| Molecular Weight | 257.67 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 4-(1-chloroethyl)-1-(2,6-difluoro-3-methylphenyl)triazole |
| SMILES | Cc1ccc(F)c(-n2cc(C(C)Cl)nn2)c1F |
| InChI | InChI=1S/C11H10ClF2N3/c1-6-3-4-8(13)11(10(6)14)17-5-9(7(2)12)15-16-17/h3-5,7H,1-2H3 |
| InChIKey | AFXNUTMGYGOLQM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|