About N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide
N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide (PubChem CID 828224) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide.
Molecular Properties
| Compound Name | N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide |
| PubChem CID | 828224 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide |
| SMILES | CC1(C)CC(=O)C=C(NNC(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C15H24N2O2/c1-15(2)9-12(8-13(18)10-15)16-17-14(19)11-6-4-3-5-7-11/h8,11,16H,3-7,9-10H2,1-2H3,(H,17,19) |
| InChIKey | SXPGCTDIZMJINT-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide?
The IUPAC name of N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide (CID 828224) is N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide.
What is the SMILES notation for N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide?
The canonical SMILES for N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide is CC1(C)CC(=O)C=C(NNC(=O)C2CCCCC2)C1.
What is the InChIKey of N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide?
The InChIKey is SXPGCTDIZMJINT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2/c1-15(2)9-12(8-13(18)10-15)16-17-14(19)11-6-4-3-5-7-11/h8,11,16H,3-7,9-10H2,1-2H3,(H,17,19).
What are the key properties of N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide?
N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide has a molecular weight of 264.37 g/mol, XLogP of 2.46, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5,5-dimethyl-3-oxocyclohexen-1-yl)cyclohexanecarbohydrazide is sourced from PubChem (CID 828224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).