C15H24N2O2 — CID 6272008
N-[(E)-(3,3-dimethyl-5-oxocyclohexylidene)amino]cyclohexanecarboxamide (PubChem CID 6272008) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is N-[(E)-(3,3-dimethyl-5-oxocyclohexylidene)amino]cyclohexanecarboxamide.
| Compound Name | N-[(E)-(3,3-dimethyl-5-oxocyclohexylidene)amino]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 6272008 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N-[(E)-(3,3-dimethyl-5-oxocyclohexylidene)amino]cyclohexanecarboxamide |
| SMILES | CC1(C)CC(=O)C/C(=N/NC(=O)C2CCCCC2)C1 |
| InChI | InChI=1S/C15H24N2O2/c1-15(2)9-12(8-13(18)10-15)16-17-14(19)11-6-4-3-5-7-11/h11H,3-10H2,1-2H3,(H,17,19)/b16-12- |
| InChIKey | QJQAAGHHLXZUIM-VBKFSLOCSA-N |
| XLogP | 2.82 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|