C14H15Cl3N2O — CID 2313217
3,3-dimethyl-5-[(2,4,6-trichlorophenyl)hydrazinylidene]cyclohexan-1-one (PubChem CID 2313217) has the molecular formula C14H15Cl3N2O and a molecular weight of 333.65 g/mol. Its IUPAC name is 3,3-dimethyl-5-[(2,4,6-trichlorophenyl)hydrazinylidene]cyclohexan-1-one.
| Compound Name | 3,3-dimethyl-5-[(2,4,6-trichlorophenyl)hydrazinylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 2313217 |
| Molecular Formula | C14H15Cl3N2O |
| Molecular Weight | 333.65 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 3,3-dimethyl-5-[(2,4,6-trichlorophenyl)hydrazinylidene]cyclohexan-1-one |
| SMILES | CC1(C)CC(=O)CC(=NNc2c(Cl)cc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C14H15Cl3N2O/c1-14(2)6-9(5-10(20)7-14)18-19-13-11(16)3-8(15)4-12(13)17/h3-4,19H,5-7H2,1-2H3 |
| InChIKey | WZBCFJKZRCASLO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.65 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|