C16H21NO2 — CID 6946965
5-[(2R)-2-hydroxy-2-phenylethyl]imino-3,3-dimethylcyclohexan-1-one (PubChem CID 6946965) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is 5-[(2R)-2-hydroxy-2-phenylethyl]imino-3,3-dimethylcyclohexan-1-one.
| Compound Name | 5-[(2R)-2-hydroxy-2-phenylethyl]imino-3,3-dimethylcyclohexan-1-one |
|---|---|
| PubChem CID | 6946965 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | 5-[(2R)-2-hydroxy-2-phenylethyl]imino-3,3-dimethylcyclohexan-1-one |
| SMILES | CC1(C)CC(=O)C/C(=N\C[C@H](O)c2ccccc2)C1 |
| InChI | InChI=1S/C16H21NO2/c1-16(2)9-13(8-14(18)10-16)17-11-15(19)12-6-4-3-5-7-12/h3-7,15,19H,8-11H2,1-2H3/b17-13+/t15-/m0/s1 |
| InChIKey | NZFCNXPBPBZGBZ-XOAFGZPJSA-N |
| XLogP | 2.94 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|