C19H23N3O2 — CID 21205161
4-[(3,3-dimethyl-5-oxocyclohexylidene)amino]-2,5-dimethyl-1-phenylpyrazol-3-one (PubChem CID 21205161) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is 4-[(3,3-dimethyl-5-oxocyclohexylidene)amino]-2,5-dimethyl-1-phenylpyrazol-3-one.
| Compound Name | 4-[(3,3-dimethyl-5-oxocyclohexylidene)amino]-2,5-dimethyl-1-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 21205161 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 4-[(3,3-dimethyl-5-oxocyclohexylidene)amino]-2,5-dimethyl-1-phenylpyrazol-3-one |
| SMILES | Cc1c(/N=C2\CC(=O)CC(C)(C)C2)c(=O)n(C)n1-c1ccccc1 |
| InChI | InChI=1S/C19H23N3O2/c1-13-17(20-14-10-16(23)12-19(2,3)11-14)18(24)21(4)22(13)15-8-6-5-7-9-15/h5-9H,10-12H2,1-4H3/b20-14+ |
| InChIKey | NHSJZZPQBPIUGI-XSFVSMFZSA-N |
| XLogP | 3.34 |
| TPSA | 56.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|