C22H19N3O3 — CID 4988629
1,5-dimethyl-4-[[5-(4-methylphenyl)-3-oxofuran-2-ylidene]amino]-2-phenylpyrazol-3-one (PubChem CID 4988629) has the molecular formula C22H19N3O3 and a molecular weight of 373.41 g/mol. Its IUPAC name is 1,5-dimethyl-4-[[5-(4-methylphenyl)-3-oxofuran-2-ylidene]amino]-2-phenylpyrazol-3-one.
| Compound Name | 1,5-dimethyl-4-[[5-(4-methylphenyl)-3-oxofuran-2-ylidene]amino]-2-phenylpyrazol-3-one |
|---|---|
| PubChem CID | 4988629 |
| Molecular Formula | C22H19N3O3 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.14 |
| IUPAC Name | 1,5-dimethyl-4-[[5-(4-methylphenyl)-3-oxofuran-2-ylidene]amino]-2-phenylpyrazol-3-one |
| SMILES | Cc1ccc(C2=CC(=O)/C(=N/c3c(C)n(C)n(-c4ccccc4)c3=O)O2)cc1 |
| InChI | InChI=1S/C22H19N3O3/c1-14-9-11-16(12-10-14)19-13-18(26)21(28-19)23-20-15(2)24(3)25(22(20)27)17-7-5-4-6-8-17/h4-13H,1-3H3/b23-21- |
| InChIKey | PSCWBNILTDVWQC-LNVKXUELSA-N |
| XLogP | 3.46 |
| TPSA | 65.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|