C18H25N2O+ — CID 7023874
3,3-dimethyl-5-[[(1R)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]methylimino]cyclohexan-1-one (PubChem CID 7023874) has the molecular formula C18H25N2O+ and a molecular weight of 285.41 g/mol. Its IUPAC name is 3,3-dimethyl-5-[[(1R)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]methylimino]cyclohexan-1-one.
| Compound Name | 3,3-dimethyl-5-[[(1R)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]methylimino]cyclohexan-1-one |
|---|---|
| PubChem CID | 7023874 |
| Molecular Formula | C18H25N2O+ |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.20 |
| IUPAC Name | 3,3-dimethyl-5-[[(1R)-1,2,3,4-tetrahydroisoquinolin-2-ium-1-yl]methylimino]cyclohexan-1-one |
| SMILES | CC1(C)CC(=O)C/C(=N/C[C@@H]2[NH2+]CCc3ccccc32)C1 |
| InChI | InChI=1S/C18H24N2O/c1-18(2)10-14(9-15(21)11-18)20-12-17-16-6-4-3-5-13(16)7-8-19-17/h3-6,17,19H,7-12H2,1-2H3/p+1/b20-14-/t17-/m0/s1 |
| InChIKey | XSORQRRNWAODPT-PNWWAVQQSA-O |
| XLogP | 2.07 |
| TPSA | 46.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|