C13H17N5O2 — CID 137271998
6-(2-hydroxy-2-phenylethyl)imino-1,2,3,3a,7,7a-hexahydropyrazolo[3,4-d]pyrimidin-4-one (PubChem CID 137271998) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 6-(2-hydroxy-2-phenylethyl)imino-1,2,3,3a,7,7a-hexahydropyrazolo[3,4-d]pyrimidin-4-one.
| Compound Name | 6-(2-hydroxy-2-phenylethyl)imino-1,2,3,3a,7,7a-hexahydropyrazolo[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 137271998 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 6-(2-hydroxy-2-phenylethyl)imino-1,2,3,3a,7,7a-hexahydropyrazolo[3,4-d]pyrimidin-4-one |
| SMILES | O=C1N/C(=N\CC(O)c2ccccc2)NC2NNCC12 |
| InChI | InChI=1S/C13H17N5O2/c19-10(8-4-2-1-3-5-8)7-14-13-16-11-9(6-15-18-11)12(20)17-13/h1-5,9-11,15,18-19H,6-7H2,(H2,14,16,17,20) |
| InChIKey | IJQAOKZLYCLPDY-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 97.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|