About 1-phenylpropan-1-ol;zirconium
1-phenylpropan-1-ol;zirconium (PubChem CID 177444291) has the molecular formula C9H11OZr-
and a molecular weight of 226.41 g/mol. Its IUPAC name is 1-phenylpropan-1-ol;zirconium.
Molecular Properties
| Compound Name | 1-phenylpropan-1-ol;zirconium |
| PubChem CID | 177444291 |
| Molecular Formula | C9H11OZr- |
| Molecular Weight | 226.41 g/mol |
| Exact Mass | 224.99 |
| IUPAC Name | 1-phenylpropan-1-ol;zirconium |
| SMILES | [CH2-]CC(O)c1ccccc1.[Zr] |
| InChI | InChI=1S/C9H11O.Zr/c1-2-9(10)8-6-4-3-5-7-8;/h3-7,9-10H,1-2H2;/q-1; |
| InChIKey | DWFGEHPHQJGSAD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.41 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylpropan-1-ol;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropan-1-ol;zirconium?
The IUPAC name of 1-phenylpropan-1-ol;zirconium (CID 177444291) is 1-phenylpropan-1-ol;zirconium.
What is the SMILES notation for 1-phenylpropan-1-ol;zirconium?
The canonical SMILES for 1-phenylpropan-1-ol;zirconium is [CH2-]CC(O)c1ccccc1.[Zr].
What is the InChIKey of 1-phenylpropan-1-ol;zirconium?
The InChIKey is DWFGEHPHQJGSAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O.Zr/c1-2-9(10)8-6-4-3-5-7-8;/h3-7,9-10H,1-2H2;/q-1;.
What are the key properties of 1-phenylpropan-1-ol;zirconium?
1-phenylpropan-1-ol;zirconium has a molecular weight of 226.41 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropan-1-ol;zirconium is sourced from PubChem (CID 177444291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).