About 1-phenylpropan-1-ol;tungsten;yttrium
1-phenylpropan-1-ol;tungsten;yttrium (PubChem CID 58630734) has the molecular formula C9H11OWY-
and a molecular weight of 407.93 g/mol. Its IUPAC name is 1-phenylpropan-1-ol;tungsten;yttrium.
Molecular Properties
| Compound Name | 1-phenylpropan-1-ol;tungsten;yttrium |
| PubChem CID | 58630734 |
| Molecular Formula | C9H11OWY- |
| Molecular Weight | 407.93 g/mol |
| Exact Mass | 407.94 |
| IUPAC Name | 1-phenylpropan-1-ol;tungsten;yttrium |
| SMILES | [CH2-]CC(O)c1ccccc1.[W].[Y] |
| InChI | InChI=1S/C9H11O.W.Y/c1-2-9(10)8-6-4-3-5-7-8;;/h3-7,9-10H,1-2H2;;/q-1;; |
| InChIKey | BKZNPIUXFRVHRB-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.93 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-phenylpropan-1-ol;tungsten;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenylpropan-1-ol;tungsten;yttrium?
The IUPAC name of 1-phenylpropan-1-ol;tungsten;yttrium (CID 58630734) is 1-phenylpropan-1-ol;tungsten;yttrium.
What is the SMILES notation for 1-phenylpropan-1-ol;tungsten;yttrium?
The canonical SMILES for 1-phenylpropan-1-ol;tungsten;yttrium is [CH2-]CC(O)c1ccccc1.[W].[Y].
What is the InChIKey of 1-phenylpropan-1-ol;tungsten;yttrium?
The InChIKey is BKZNPIUXFRVHRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O.W.Y/c1-2-9(10)8-6-4-3-5-7-8;;/h3-7,9-10H,1-2H2;;/q-1;;.
What are the key properties of 1-phenylpropan-1-ol;tungsten;yttrium?
1-phenylpropan-1-ol;tungsten;yttrium has a molecular weight of 407.93 g/mol, XLogP of 1.94, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenylpropan-1-ol;tungsten;yttrium is sourced from PubChem (CID 58630734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).