C12H12Cl3NO2 — CID 11209044
5,5-dimethyl-3-(2,4,6-trichloroanilino)oxolan-2-one (PubChem CID 11209044) has the molecular formula C12H12Cl3NO2 and a molecular weight of 308.59 g/mol. Its IUPAC name is 5,5-dimethyl-3-(2,4,6-trichloroanilino)oxolan-2-one.
| Compound Name | 5,5-dimethyl-3-(2,4,6-trichloroanilino)oxolan-2-one |
|---|---|
| PubChem CID | 11209044 |
| Molecular Formula | C12H12Cl3NO2 |
| Molecular Weight | 308.59 g/mol |
| Exact Mass | 306.99 |
| IUPAC Name | 5,5-dimethyl-3-(2,4,6-trichloroanilino)oxolan-2-one |
| SMILES | CC1(C)CC(Nc2c(Cl)cc(Cl)cc2Cl)C(=O)O1 |
| InChI | InChI=1S/C12H12Cl3NO2/c1-12(2)5-9(11(17)18-12)16-10-7(14)3-6(13)4-8(10)15/h3-4,9,16H,5H2,1-2H3 |
| InChIKey | AVILXRDSVGLEAZ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.59 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |