C11H10Cl4N2O — CID 163728752
4-chloro-5,5-dimethyl-2-(2,4,6-trichlorophenyl)pyrazolidin-3-one (PubChem CID 163728752) has the molecular formula C11H10Cl4N2O and a molecular weight of 328.03 g/mol. Its IUPAC name is 4-chloro-5,5-dimethyl-2-(2,4,6-trichlorophenyl)pyrazolidin-3-one.
| Compound Name | 4-chloro-5,5-dimethyl-2-(2,4,6-trichlorophenyl)pyrazolidin-3-one |
|---|---|
| PubChem CID | 163728752 |
| Molecular Formula | C11H10Cl4N2O |
| Molecular Weight | 328.03 g/mol |
| Exact Mass | 325.95 |
| IUPAC Name | 4-chloro-5,5-dimethyl-2-(2,4,6-trichlorophenyl)pyrazolidin-3-one |
| SMILES | CC1(C)NN(c2c(Cl)cc(Cl)cc2Cl)C(=O)C1Cl |
| InChI | InChI=1S/C11H10Cl4N2O/c1-11(2)9(15)10(18)17(16-11)8-6(13)3-5(12)4-7(8)14/h3-4,9,16H,1-2H3 |
| InChIKey | KXUXSYVPDRGRRC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.03 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|