C16H16F3NO2 — CID 134387048
N-(5,5-dimethyl-3-oxocyclohexen-1-yl)-4-(trifluoromethyl)benzamide (PubChem CID 134387048) has the molecular formula C16H16F3NO2 and a molecular weight of 311.30 g/mol. Its IUPAC name is N-(5,5-dimethyl-3-oxocyclohexen-1-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(5,5-dimethyl-3-oxocyclohexen-1-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 134387048 |
| Molecular Formula | C16H16F3NO2 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | N-(5,5-dimethyl-3-oxocyclohexen-1-yl)-4-(trifluoromethyl)benzamide |
| SMILES | CC1(C)CC(=O)C=C(NC(=O)c2ccc(C(F)(F)F)cc2)C1 |
| InChI | InChI=1S/C16H16F3NO2/c1-15(2)8-12(7-13(21)9-15)20-14(22)10-3-5-11(6-4-10)16(17,18)19/h3-7H,8-9H2,1-2H3,(H,20,22) |
| InChIKey | YBJGRWJTVMEACN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |