C18H23N3O3 — CID 3386613
N-[1-[2-(5,5-dimethyl-3-oxocyclohexen-1-yl)hydrazinyl]-1-oxopropan-2-yl]benzamide (PubChem CID 3386613) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is N-[1-[2-(5,5-dimethyl-3-oxocyclohexen-1-yl)hydrazinyl]-1-oxopropan-2-yl]benzamide.
| Compound Name | N-[1-[2-(5,5-dimethyl-3-oxocyclohexen-1-yl)hydrazinyl]-1-oxopropan-2-yl]benzamide |
|---|---|
| PubChem CID | 3386613 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | N-[1-[2-(5,5-dimethyl-3-oxocyclohexen-1-yl)hydrazinyl]-1-oxopropan-2-yl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1)C(=O)NNC1=CC(=O)CC(C)(C)C1 |
| InChI | InChI=1S/C18H23N3O3/c1-12(19-17(24)13-7-5-4-6-8-13)16(23)21-20-14-9-15(22)11-18(2,3)10-14/h4-9,12,20H,10-11H2,1-3H3,(H,19,24)(H,21,23) |
| InChIKey | AQAJISKGPATINN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|