C16H20N4O — CID 82823553
5-[4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)phenyl]-1,2-dihydropyrazol-3-one (PubChem CID 82823553) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 5-[4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)phenyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-[4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)phenyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 82823553 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 5-[4-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)phenyl]-1,2-dihydropyrazol-3-one |
| SMILES | O=c1cc(-c2ccc(NC3CCN4CCCC34)cc2)[nH][nH]1 |
| InChI | InChI=1S/C16H20N4O/c21-16-10-14(18-19-16)11-3-5-12(6-4-11)17-13-7-9-20-8-1-2-15(13)20/h3-6,10,13,15,17H,1-2,7-9H2,(H2,18,19,21) |
| InChIKey | SKEJTBXDUFUESU-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 63.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |