C15H19N3O — CID 62070349
5-[4-(cyclopentylmethylamino)phenyl]-1,2-dihydropyrazol-3-one (PubChem CID 62070349) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 5-[4-(cyclopentylmethylamino)phenyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-[4-(cyclopentylmethylamino)phenyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 62070349 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 5-[4-(cyclopentylmethylamino)phenyl]-1,2-dihydropyrazol-3-one |
| SMILES | O=c1cc(-c2ccc(NCC3CCCC3)cc2)[nH][nH]1 |
| InChI | InChI=1S/C15H19N3O/c19-15-9-14(17-18-15)12-5-7-13(8-6-12)16-10-11-3-1-2-4-11/h5-9,11,16H,1-4,10H2,(H2,17,18,19) |
| InChIKey | PIFXULYCWCIVSM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |