C14H19N3O — CID 43708921
5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one (PubChem CID 43708921) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one.
| Compound Name | 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 43708921 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one |
| SMILES | CC(C)CCNc1ccc(-c2cc(=O)[nH][nH]2)cc1 |
| InChI | InChI=1S/C14H19N3O/c1-10(2)7-8-15-12-5-3-11(4-6-12)13-9-14(18)17-16-13/h3-6,9-10,15H,7-8H2,1-2H3,(H2,16,17,18) |
| InChIKey | WZDSOQFFVHNHFQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |