About 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one
5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one (PubChem CID 43708921) has the molecular formula C14H19N3O
and a molecular weight of 245.33 g/mol. Its IUPAC name is 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one |
| PubChem CID | 43708921 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one |
| SMILES | CC(C)CCNc1ccc(-c2cc(=O)[nH][nH]2)cc1 |
| InChI | InChI=1S/C14H19N3O/c1-10(2)7-8-15-12-5-3-11(4-6-12)13-9-14(18)17-16-13/h3-6,9-10,15H,7-8H2,1-2H3,(H2,16,17,18) |
| InChIKey | WZDSOQFFVHNHFQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 60.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one (CID 43708921) is 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one is CC(C)CCNc1ccc(-c2cc(=O)[nH][nH]2)cc1.
What is the InChIKey of 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one?
The InChIKey is WZDSOQFFVHNHFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N3O/c1-10(2)7-8-15-12-5-3-11(4-6-12)13-9-14(18)17-16-13/h3-6,9-10,15H,7-8H2,1-2H3,(H2,16,17,18).
What are the key properties of 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one?
5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one has a molecular weight of 245.33 g/mol, XLogP of 2.83, 5 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(3-methylbutylamino)phenyl]-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 43708921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).