C15H18N4O2 — CID 82824593
6-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 82824593) has the molecular formula C15H18N4O2 and a molecular weight of 286.33 g/mol. Its IUPAC name is 6-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 82824593 |
| Molecular Formula | C15H18N4O2 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | 6-(2,3,5,6,7,8-hexahydro-1H-pyrrolizin-1-ylamino)-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc(NC3CCN4CCCC34)cc2[nH]c1=O |
| InChI | InChI=1S/C15H18N4O2/c20-14-15(21)18-12-8-9(3-4-10(12)17-14)16-11-5-7-19-6-1-2-13(11)19/h3-4,8,11,13,16H,1-2,5-7H2,(H,17,20)(H,18,21) |
| InChIKey | IXLIBDXFNZYEBE-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|