C16H22BrNO2 — CID 82823611
(3-bromophenyl)methyl 1-amino-4-ethylcyclohexane-1-carboxylate (PubChem CID 82823611) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is (3-bromophenyl)methyl 1-amino-4-ethylcyclohexane-1-carboxylate.
| Compound Name | (3-bromophenyl)methyl 1-amino-4-ethylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 82823611 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | (3-bromophenyl)methyl 1-amino-4-ethylcyclohexane-1-carboxylate |
| SMILES | CCC1CCC(N)(C(=O)OCc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C16H22BrNO2/c1-2-12-6-8-16(18,9-7-12)15(19)20-11-13-4-3-5-14(17)10-13/h3-5,10,12H,2,6-9,11,18H2,1H3 |
| InChIKey | PQHPXDCXAWWEEO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |