C13H15FN2O — CID 82837872
2-(3-fluoroanilino)-2-(5-methyloxolan-2-yl)acetonitrile (PubChem CID 82837872) has the molecular formula C13H15FN2O and a molecular weight of 234.27 g/mol. Its IUPAC name is 2-(3-fluoroanilino)-2-(5-methyloxolan-2-yl)acetonitrile.
| Compound Name | 2-(3-fluoroanilino)-2-(5-methyloxolan-2-yl)acetonitrile |
|---|---|
| PubChem CID | 82837872 |
| Molecular Formula | C13H15FN2O |
| Molecular Weight | 234.27 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 2-(3-fluoroanilino)-2-(5-methyloxolan-2-yl)acetonitrile |
| SMILES | CC1CCC(C(C#N)Nc2cccc(F)c2)O1 |
| InChI | InChI=1S/C13H15FN2O/c1-9-5-6-13(17-9)12(8-15)16-11-4-2-3-10(14)7-11/h2-4,7,9,12-13,16H,5-6H2,1H3 |
| InChIKey | KGSZYYUBZSAETI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.27 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |