C13H21NO3 — CID 82838057
3-(2-methylpropyl)-4-(oxolan-2-yl)piperidine-2,6-dione (PubChem CID 82838057) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 3-(2-methylpropyl)-4-(oxolan-2-yl)piperidine-2,6-dione.
| Compound Name | 3-(2-methylpropyl)-4-(oxolan-2-yl)piperidine-2,6-dione |
|---|---|
| PubChem CID | 82838057 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 3-(2-methylpropyl)-4-(oxolan-2-yl)piperidine-2,6-dione |
| SMILES | CC(C)CC1C(=O)NC(=O)CC1C1CCCO1 |
| InChI | InChI=1S/C13H21NO3/c1-8(2)6-10-9(11-4-3-5-17-11)7-12(15)14-13(10)16/h8-11H,3-7H2,1-2H3,(H,14,15,16) |
| InChIKey | BNPDBXNWNMQZIF-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|