C9H21N3O4S2 — CID 82840219
N-[1-(2-aminoethyl)piperidin-4-yl]-1-methylsulfonylmethanesulfonamide (PubChem CID 82840219) has the molecular formula C9H21N3O4S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is N-[1-(2-aminoethyl)piperidin-4-yl]-1-methylsulfonylmethanesulfonamide.
| Compound Name | N-[1-(2-aminoethyl)piperidin-4-yl]-1-methylsulfonylmethanesulfonamide |
|---|---|
| PubChem CID | 82840219 |
| Molecular Formula | C9H21N3O4S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | N-[1-(2-aminoethyl)piperidin-4-yl]-1-methylsulfonylmethanesulfonamide |
| SMILES | CS(=O)(=O)CS(=O)(=O)NC1CCN(CCN)CC1 |
| InChI | InChI=1S/C9H21N3O4S2/c1-17(13,14)8-18(15,16)11-9-2-5-12(6-3-9)7-4-10/h9,11H,2-8,10H2,1H3 |
| InChIKey | XOWDEJKTLUGPJT-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |