C13H21NO5S — CID 82841057
(2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(thiolane-2-carbonylamino)butanoic acid (PubChem CID 82841057) has the molecular formula C13H21NO5S and a molecular weight of 303.38 g/mol. Its IUPAC name is (2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(thiolane-2-carbonylamino)butanoic acid.
| Compound Name | (2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(thiolane-2-carbonylamino)butanoic acid |
|---|---|
| PubChem CID | 82841057 |
| Molecular Formula | C13H21NO5S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | (2S)-4-[(2-methylpropan-2-yl)oxy]-4-oxo-2-(thiolane-2-carbonylamino)butanoic acid |
| SMILES | CC(C)(C)OC(=O)C[C@H](NC(=O)C1CCCS1)C(=O)O |
| InChI | InChI=1S/C13H21NO5S/c1-13(2,3)19-10(15)7-8(12(17)18)14-11(16)9-5-4-6-20-9/h8-9H,4-7H2,1-3H3,(H,14,16)(H,17,18)/t8-,9?/m0/s1 |
| InChIKey | NOHXBOSRDBKARM-IENPIDJESA-N |
| XLogP | 1.18 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |