C14H25NO3S — CID 81004182
tert-butyl (2R)-3-methyl-2-(thiolane-2-carbonylamino)butanoate (PubChem CID 81004182) has the molecular formula C14H25NO3S and a molecular weight of 287.42 g/mol. Its IUPAC name is tert-butyl (2R)-3-methyl-2-(thiolane-2-carbonylamino)butanoate.
| Compound Name | tert-butyl (2R)-3-methyl-2-(thiolane-2-carbonylamino)butanoate |
|---|---|
| PubChem CID | 81004182 |
| Molecular Formula | C14H25NO3S |
| Molecular Weight | 287.42 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | tert-butyl (2R)-3-methyl-2-(thiolane-2-carbonylamino)butanoate |
| SMILES | CC(C)[C@@H](NC(=O)C1CCCS1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO3S/c1-9(2)11(13(17)18-14(3,4)5)15-12(16)10-7-6-8-19-10/h9-11H,6-8H2,1-5H3,(H,15,16)/t10?,11-/m1/s1 |
| InChIKey | ZNUVLSQHGACYGP-RRKGBCIJSA-N |
| XLogP | 2.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.42 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |