C8H17N3O4S2 — CID 82843404
1-(methylsulfonylmethylsulfonyl)piperidine-3-carboximidamide (PubChem CID 82843404) has the molecular formula C8H17N3O4S2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 1-(methylsulfonylmethylsulfonyl)piperidine-3-carboximidamide.
| Compound Name | 1-(methylsulfonylmethylsulfonyl)piperidine-3-carboximidamide |
|---|---|
| PubChem CID | 82843404 |
| Molecular Formula | C8H17N3O4S2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 1-(methylsulfonylmethylsulfonyl)piperidine-3-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCCN(S(=O)(=O)CS(C)(=O)=O)C1 |
| InChI | InChI=1S/C8H17N3O4S2/c1-16(12,13)6-17(14,15)11-4-2-3-7(5-11)8(9)10/h7H,2-6H2,1H3,(H3,9,10) |
| InChIKey | WFRZKFIYTUARKE-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 121.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|