C8H17N3O3S — CID 77041761
1-ethylsulfonyl-N'-hydroxypiperidine-3-carboximidamide (PubChem CID 77041761) has the molecular formula C8H17N3O3S and a molecular weight of 235.31 g/mol. Its IUPAC name is 1-ethylsulfonyl-N'-hydroxypiperidine-3-carboximidamide.
| Compound Name | 1-ethylsulfonyl-N'-hydroxypiperidine-3-carboximidamide |
|---|---|
| PubChem CID | 77041761 |
| Molecular Formula | C8H17N3O3S |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 1-ethylsulfonyl-N'-hydroxypiperidine-3-carboximidamide |
| SMILES | CCS(=O)(=O)N1CCCC(C(N)=NO)C1 |
| InChI | InChI=1S/C8H17N3O3S/c1-2-15(13,14)11-5-3-4-7(6-11)8(9)10-12/h7,12H,2-6H2,1H3,(H2,9,10) |
| InChIKey | SEAQUTTVYKKAIR-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|