C15H21ClN2O2 — CID 82850224
3-[6-chloro-3-(propylaminomethyl)indol-1-yl]propane-1,2-diol (PubChem CID 82850224) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is 3-[6-chloro-3-(propylaminomethyl)indol-1-yl]propane-1,2-diol.
| Compound Name | 3-[6-chloro-3-(propylaminomethyl)indol-1-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 82850224 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 3-[6-chloro-3-(propylaminomethyl)indol-1-yl]propane-1,2-diol |
| SMILES | CCCNCc1cn(CC(O)CO)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C15H21ClN2O2/c1-2-5-17-7-11-8-18(9-13(20)10-19)15-6-12(16)3-4-14(11)15/h3-4,6,8,13,17,19-20H,2,5,7,9-10H2,1H3 |
| InChIKey | NBUZCWVHUBSWAW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|