C14H26N4O2 — CID 82863355
2-(2-hydroxy-3-piperazin-1-ylpropyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one (PubChem CID 82863355) has the molecular formula C14H26N4O2 and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-(2-hydroxy-3-piperazin-1-ylpropyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one.
| Compound Name | 2-(2-hydroxy-3-piperazin-1-ylpropyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
|---|---|
| PubChem CID | 82863355 |
| Molecular Formula | C14H26N4O2 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 2-(2-hydroxy-3-piperazin-1-ylpropyl)-1,3,4,7,8,8a-hexahydropyrrolo[1,2-a]pyrazin-6-one |
| SMILES | O=C1CCC2CN(CC(O)CN3CCNCC3)CCN12 |
| InChI | InChI=1S/C14H26N4O2/c19-13(10-16-5-3-15-4-6-16)11-17-7-8-18-12(9-17)1-2-14(18)20/h12-13,15,19H,1-11H2 |
| InChIKey | OOGRDFDGXABEFZ-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 59.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |