C10H19N5 — CID 82866218
3-[methyl-[(1-methylpyrazol-3-yl)methyl]amino]butanimidamide (PubChem CID 82866218) has the molecular formula C10H19N5 and a molecular weight of 209.30 g/mol. Its IUPAC name is 3-[methyl-[(1-methylpyrazol-3-yl)methyl]amino]butanimidamide.
| Compound Name | 3-[methyl-[(1-methylpyrazol-3-yl)methyl]amino]butanimidamide |
|---|---|
| PubChem CID | 82866218 |
| Molecular Formula | C10H19N5 |
| Molecular Weight | 209.30 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 3-[methyl-[(1-methylpyrazol-3-yl)methyl]amino]butanimidamide |
| SMILES | [H]/N=C(\N)CC(C)N(C)Cc1ccn(C)n1 |
| InChI | InChI=1S/C10H19N5/c1-8(6-10(11)12)14(2)7-9-4-5-15(3)13-9/h4-5,8H,6-7H2,1-3H3,(H3,11,12) |
| InChIKey | GBQLOPLTBKWHEO-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 70.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.30 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|