C11H13BrN2O — CID 82868277
N-(4-bromo-3-methoxyphenyl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 82868277) has the molecular formula C11H13BrN2O and a molecular weight of 269.14 g/mol. Its IUPAC name is N-(4-bromo-3-methoxyphenyl)-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N-(4-bromo-3-methoxyphenyl)-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 82868277 |
| Molecular Formula | C11H13BrN2O |
| Molecular Weight | 269.14 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | N-(4-bromo-3-methoxyphenyl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | COc1cc(NC2=NCCC2)ccc1Br |
| InChI | InChI=1S/C11H13BrN2O/c1-15-10-7-8(4-5-9(10)12)14-11-3-2-6-13-11/h4-5,7H,2-3,6H2,1H3,(H,13,14) |
| InChIKey | ZZWKOVPPPXUPPX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.14 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |