C17H16N2 — CID 78909221
N-(9H-fluoren-2-yl)-3,4-dihydro-2H-pyrrol-5-amine (PubChem CID 78909221) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N-(9H-fluoren-2-yl)-3,4-dihydro-2H-pyrrol-5-amine.
| Compound Name | N-(9H-fluoren-2-yl)-3,4-dihydro-2H-pyrrol-5-amine |
|---|---|
| PubChem CID | 78909221 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | N-(9H-fluoren-2-yl)-3,4-dihydro-2H-pyrrol-5-amine |
| SMILES | c1ccc2c(c1)Cc1cc(NC3=NCCC3)ccc1-2 |
| InChI | InChI=1S/C17H16N2/c1-2-5-15-12(4-1)10-13-11-14(7-8-16(13)15)19-17-6-3-9-18-17/h1-2,4-5,7-8,11H,3,6,9-10H2,(H,18,19) |
| InChIKey | ITWCLWCLGDNVBR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |