C15H8Cl4N2 — CID 82870560
4,6,8-trichloro-2-(5-chloro-2-methylphenyl)quinazoline (PubChem CID 82870560) has the molecular formula C15H8Cl4N2 and a molecular weight of 358.06 g/mol. Its IUPAC name is 4,6,8-trichloro-2-(5-chloro-2-methylphenyl)quinazoline.
| Compound Name | 4,6,8-trichloro-2-(5-chloro-2-methylphenyl)quinazoline |
|---|---|
| PubChem CID | 82870560 |
| Molecular Formula | C15H8Cl4N2 |
| Molecular Weight | 358.06 g/mol |
| Exact Mass | 355.94 |
| IUPAC Name | 4,6,8-trichloro-2-(5-chloro-2-methylphenyl)quinazoline |
| SMILES | Cc1ccc(Cl)cc1-c1nc(Cl)c2cc(Cl)cc(Cl)c2n1 |
| InChI | InChI=1S/C15H8Cl4N2/c1-7-2-3-8(16)4-10(7)15-20-13-11(14(19)21-15)5-9(17)6-12(13)18/h2-6H,1H3 |
| InChIKey | PSCTWDWDNCCPRV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.06 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |