About 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine
2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine (PubChem CID 828748) has the molecular formula C8H10N4O3S
and a molecular weight of 242.26 g/mol. Its IUPAC name is 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine |
| PubChem CID | 828748 |
| Molecular Formula | C8H10N4O3S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine |
| SMILES | CCS(=O)(=O)n1nc(-c2ccco2)nc1N |
| InChI | InChI=1S/C8H10N4O3S/c1-2-16(13,14)12-8(9)10-7(11-12)6-4-3-5-15-6/h3-5H,2H2,1H3,(H2,9,10,11) |
| InChIKey | TYOOLEOCWDOHQL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine?
The IUPAC name of 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine (CID 828748) is 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine.
What is the SMILES notation for 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine?
The canonical SMILES for 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine is CCS(=O)(=O)n1nc(-c2ccco2)nc1N.
What is the InChIKey of 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine?
The InChIKey is TYOOLEOCWDOHQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O3S/c1-2-16(13,14)12-8(9)10-7(11-12)6-4-3-5-15-6/h3-5H,2H2,1H3,(H2,9,10,11).
What are the key properties of 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine?
2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine has a molecular weight of 242.26 g/mol, XLogP of 0.32, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine is sourced from PubChem (CID 828748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).