C8H10N4O3S — CID 828748
2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine (PubChem CID 828748) has the molecular formula C8H10N4O3S and a molecular weight of 242.26 g/mol. Its IUPAC name is 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine.
| Compound Name | 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 828748 |
| Molecular Formula | C8H10N4O3S |
| Molecular Weight | 242.26 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 2-ethylsulfonyl-5-(furan-2-yl)-1,2,4-triazol-3-amine |
| SMILES | CCS(=O)(=O)n1nc(-c2ccco2)nc1N |
| InChI | InChI=1S/C8H10N4O3S/c1-2-16(13,14)12-8(9)10-7(11-12)6-4-3-5-15-6/h3-5H,2H2,1H3,(H2,9,10,11) |
| InChIKey | TYOOLEOCWDOHQL-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |