C14H13FN2O3S — CID 82877147
4-[[2-(2-fluorophenyl)sulfanylacetyl]amino]-2-methyl-1H-pyrrole-3-carboxylic acid (PubChem CID 82877147) has the molecular formula C14H13FN2O3S and a molecular weight of 308.33 g/mol. Its IUPAC name is 4-[[2-(2-fluorophenyl)sulfanylacetyl]amino]-2-methyl-1H-pyrrole-3-carboxylic acid.
| Compound Name | 4-[[2-(2-fluorophenyl)sulfanylacetyl]amino]-2-methyl-1H-pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 82877147 |
| Molecular Formula | C14H13FN2O3S |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 4-[[2-(2-fluorophenyl)sulfanylacetyl]amino]-2-methyl-1H-pyrrole-3-carboxylic acid |
| SMILES | Cc1[nH]cc(NC(=O)CSc2ccccc2F)c1C(=O)O |
| InChI | InChI=1S/C14H13FN2O3S/c1-8-13(14(19)20)10(6-16-8)17-12(18)7-21-11-5-3-2-4-9(11)15/h2-6,16H,7H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | WILARBFIEBNKAT-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |