About 5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide
5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide (PubChem CID 82885260) has the molecular formula C13H17ClN2O2S
and a molecular weight of 300.81 g/mol. Its IUPAC name is 5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide.
Molecular Properties
| Compound Name | 5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide |
| PubChem CID | 82885260 |
| Molecular Formula | C13H17ClN2O2S |
| Molecular Weight | 300.81 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide |
| SMILES | C#CCN(C)S(=O)(=O)c1cc(Cl)cc(CNC)c1C |
| InChI | InChI=1S/C13H17ClN2O2S/c1-5-6-16(4)19(17,18)13-8-12(14)7-11(9-15-3)10(13)2/h1,7-8,15H,6,9H2,2-4H3 |
| InChIKey | FMASSAUHIZSOTK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.81 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide?
The IUPAC name of 5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide (CID 82885260) is 5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide.
What is the SMILES notation for 5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide?
The canonical SMILES for 5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide is C#CCN(C)S(=O)(=O)c1cc(Cl)cc(CNC)c1C.
What is the InChIKey of 5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide?
The InChIKey is FMASSAUHIZSOTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O2S/c1-5-6-16(4)19(17,18)13-8-12(14)7-11(9-15-3)10(13)2/h1,7-8,15H,6,9H2,2-4H3.
What are the key properties of 5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide?
5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide has a molecular weight of 300.81 g/mol, XLogP of 1.62, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-N,2-dimethyl-3-(methylaminomethyl)-N-prop-2-ynylbenzenesulfonamide is sourced from PubChem (CID 82885260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).